C21H16N2O3S — CID 51327730
N-[4-[(1-benzothiophene-2-carbonylamino)methyl]phenyl]furan-2-carboxamide (PubChem CID 51327730) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-[4-[(1-benzothiophene-2-carbonylamino)methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(1-benzothiophene-2-carbonylamino)methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51327730 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-[4-[(1-benzothiophene-2-carbonylamino)methyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(CNC(=O)c2cc3ccccc3s2)cc1)c1ccco1 |
| InChI | InChI=1S/C21H16N2O3S/c24-20(17-5-3-11-26-17)23-16-9-7-14(8-10-16)13-22-21(25)19-12-15-4-1-2-6-18(15)27-19/h1-12H,13H2,(H,22,25)(H,23,24) |
| InChIKey | OZZAUTMHYCCKAT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |