C19H14N4O7 — CID 42017854
N-[4-[[(3,5-dinitrobenzoyl)amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 42017854) has the molecular formula C19H14N4O7 and a molecular weight of 410.34 g/mol. Its IUPAC name is N-[4-[[(3,5-dinitrobenzoyl)amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[(3,5-dinitrobenzoyl)amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42017854 |
| Molecular Formula | C19H14N4O7 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-[4-[[(3,5-dinitrobenzoyl)amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(NCc1ccc(NC(=O)c2ccco2)cc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H14N4O7/c24-18(13-8-15(22(26)27)10-16(9-13)23(28)29)20-11-12-3-5-14(6-4-12)21-19(25)17-2-1-7-30-17/h1-10H,11H2,(H,20,24)(H,21,25) |
| InChIKey | CSNORQHPMPOPLG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 157.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|