C18H15N3O4 — CID 42018045
N-[[4-(furan-2-carbonylamino)phenyl]methyl]-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 42018045) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is N-[[4-(furan-2-carbonylamino)phenyl]methyl]-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-[[4-(furan-2-carbonylamino)phenyl]methyl]-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 42018045 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-[[4-(furan-2-carbonylamino)phenyl]methyl]-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | O=C(NCc1ccc(NC(=O)c2ccco2)cc1)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C18H15N3O4/c22-17(14-7-9-21(24)10-8-14)19-12-13-3-5-15(6-4-13)20-18(23)16-2-1-11-25-16/h1-11H,12H2,(H,19,22)(H,20,23) |
| InChIKey | JUWRKNKETMMMGG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|