C19H15ClN2O3 — CID 46671768
N-[4-[(3-chlorophenyl)methylcarbamoyl]phenyl]furan-2-carboxamide (PubChem CID 46671768) has the molecular formula C19H15ClN2O3 and a molecular weight of 354.79 g/mol. Its IUPAC name is N-[4-[(3-chlorophenyl)methylcarbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(3-chlorophenyl)methylcarbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46671768 |
| Molecular Formula | C19H15ClN2O3 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | N-[4-[(3-chlorophenyl)methylcarbamoyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)c1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C19H15ClN2O3/c20-15-4-1-3-13(11-15)12-21-18(23)14-6-8-16(9-7-14)22-19(24)17-5-2-10-25-17/h1-11H,12H2,(H,21,23)(H,22,24) |
| InChIKey | ZCBQUPMVBMFZDY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |