C25H23N5O5 — CID 42018140
N-[4-[[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 42018140) has the molecular formula C25H23N5O5 and a molecular weight of 473.49 g/mol. Its IUPAC name is N-[4-[[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42018140 |
| Molecular Formula | C25H23N5O5 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | N-[4-[[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | Cc1nn(Cc2ccc(C(=O)NCc3ccc(NC(=O)c4ccco4)cc3)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C25H23N5O5/c1-16-23(30(33)34)17(2)29(28-16)15-19-5-9-20(10-6-19)24(31)26-14-18-7-11-21(12-8-18)27-25(32)22-4-3-13-35-22/h3-13H,14-15H2,1-2H3,(H,26,31)(H,27,32) |
| InChIKey | OCPQTRDIASPVOY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|