C20H21N5O5 — CID 9080748
4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide (PubChem CID 9080748) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide.
| Compound Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9080748 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide |
| SMILES | Cc1nn(Cc2ccc(C(=O)NCC(=O)NCc3ccco3)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H21N5O5/c1-13-19(25(28)29)14(2)24(23-13)12-15-5-7-16(8-6-15)20(27)22-11-18(26)21-10-17-4-3-9-30-17/h3-9H,10-12H2,1-2H3,(H,21,26)(H,22,27) |
| InChIKey | QZVRFNQACKVUEJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|