C19H20N4O4 — CID 9482200
4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[(1S)-1-(furan-2-yl)ethyl]benzamide (PubChem CID 9482200) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[(1S)-1-(furan-2-yl)ethyl]benzamide.
| Compound Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[(1S)-1-(furan-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 9482200 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[(1S)-1-(furan-2-yl)ethyl]benzamide |
| SMILES | Cc1nn(Cc2ccc(C(=O)N[C@@H](C)c3ccco3)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20N4O4/c1-12(17-5-4-10-27-17)20-19(24)16-8-6-15(7-9-16)11-22-14(3)18(23(25)26)13(2)21-22/h4-10,12H,11H2,1-3H3,(H,20,24)/t12-/m0/s1 |
| InChIKey | LWXFTNDQIYHYRV-LBPRGKRZSA-N |
| XLogP | 3.54 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|