C23H28N5O3+ — CID 8937888
[(2S)-2-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]-2-phenylethyl]-dimethylazanium (PubChem CID 8937888) has the molecular formula C23H28N5O3+ and a molecular weight of 422.51 g/mol. Its IUPAC name is [(2S)-2-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]-2-phenylethyl]-dimethylazanium.
| Compound Name | [(2S)-2-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]-2-phenylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8937888 |
| Molecular Formula | C23H28N5O3+ |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [(2S)-2-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]-2-phenylethyl]-dimethylazanium |
| SMILES | Cc1nn(Cc2ccc(C(=O)N[C@H](C[NH+](C)C)c3ccccc3)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H27N5O3/c1-16-22(28(30)31)17(2)27(25-16)14-18-10-12-20(13-11-18)23(29)24-21(15-26(3)4)19-8-6-5-7-9-19/h5-13,21H,14-15H2,1-4H3,(H,24,29)/p+1/t21-/m1/s1 |
| InChIKey | YVXHTCRKSNUKEE-OAQYLSRUSA-O |
| XLogP | 2.07 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|