C23H22N4O7 — CID 46612213
dimethyl 5-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]benzene-1,3-dicarboxylate (PubChem CID 46612213) has the molecular formula C23H22N4O7 and a molecular weight of 466.45 g/mol. Its IUPAC name is dimethyl 5-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 46612213 |
| Molecular Formula | C23H22N4O7 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | dimethyl 5-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2ccc(Cn3nc(C)c([N+](=O)[O-])c3C)cc2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C23H22N4O7/c1-13-20(27(31)32)14(2)26(25-13)12-15-5-7-16(8-6-15)21(28)24-19-10-17(22(29)33-3)9-18(11-19)23(30)34-4/h5-11H,12H2,1-4H3,(H,24,28) |
| InChIKey | HMHJVKTWJPIAOH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 142.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|