C15H11NO2S3 — CID 80738759
N-[[3-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]thieno[3,2-b]thiophene-5-carboxamide (PubChem CID 80738759) has the molecular formula C15H11NO2S3 and a molecular weight of 333.46 g/mol. Its IUPAC name is N-[[3-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]thieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-[[3-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]thieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 80738759 |
| Molecular Formula | C15H11NO2S3 |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | N-[[3-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]thieno[3,2-b]thiophene-5-carboxamide |
| SMILES | O=C(NCc1sccc1C#CCO)c1cc2sccc2s1 |
| InChI | InChI=1S/C15H11NO2S3/c17-5-1-2-10-3-6-20-14(10)9-16-15(18)13-8-12-11(21-13)4-7-19-12/h3-4,6-8,17H,5,9H2,(H,16,18) |
| InChIKey | WZPIRSSJFWKEMB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|