C13H10Cl2N2OS2 — CID 107964048
N-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-2,5-dichlorothiophene-3-carboxamide (PubChem CID 107964048) has the molecular formula C13H10Cl2N2OS2 and a molecular weight of 345.28 g/mol. Its IUPAC name is N-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-2,5-dichlorothiophene-3-carboxamide.
| Compound Name | N-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-2,5-dichlorothiophene-3-carboxamide |
|---|---|
| PubChem CID | 107964048 |
| Molecular Formula | C13H10Cl2N2OS2 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | N-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-2,5-dichlorothiophene-3-carboxamide |
| SMILES | NCC#Cc1ccsc1CNC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C13H10Cl2N2OS2/c14-11-6-9(12(15)20-11)13(18)17-7-10-8(2-1-4-16)3-5-19-10/h3,5-6H,4,7,16H2,(H,17,18) |
| InChIKey | JGVHEPMGJQQCSS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|