C13H9Cl2NO2S2 — CID 107963931
2,5-dichloro-N-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]thiophene-3-carboxamide (PubChem CID 107963931) has the molecular formula C13H9Cl2NO2S2 and a molecular weight of 346.26 g/mol. Its IUPAC name is 2,5-dichloro-N-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107963931 |
| Molecular Formula | C13H9Cl2NO2S2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | 2,5-dichloro-N-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]thiophene-3-carboxamide |
| SMILES | O=C(NCc1ccc(C#CCO)s1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C13H9Cl2NO2S2/c14-11-6-10(12(15)20-11)13(18)16-7-9-4-3-8(19-9)2-1-5-17/h3-4,6,17H,5,7H2,(H,16,18) |
| InChIKey | SSTYRSCCYPHYOX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|