C11H9N3O2S2 — CID 65215798
N-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]thiadiazole-4-carboxamide (PubChem CID 65215798) has the molecular formula C11H9N3O2S2 and a molecular weight of 279.35 g/mol. Its IUPAC name is N-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]thiadiazole-4-carboxamide.
| Compound Name | N-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 65215798 |
| Molecular Formula | C11H9N3O2S2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | N-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]thiadiazole-4-carboxamide |
| SMILES | O=C(NCc1ccc(C#CCO)s1)c1csnn1 |
| InChI | InChI=1S/C11H9N3O2S2/c15-5-1-2-8-3-4-9(18-8)6-12-11(16)10-7-17-14-13-10/h3-4,7,15H,5-6H2,(H,12,16) |
| InChIKey | PDAKVTFPOUIHHH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|