C8H6BrN3OS2 — CID 47352361
N-[(4-bromothiophen-2-yl)methyl]thiadiazole-4-carboxamide (PubChem CID 47352361) has the molecular formula C8H6BrN3OS2 and a molecular weight of 304.19 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]thiadiazole-4-carboxamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 47352361 |
| Molecular Formula | C8H6BrN3OS2 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 302.91 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]thiadiazole-4-carboxamide |
| SMILES | O=C(NCc1cc(Br)cs1)c1csnn1 |
| InChI | InChI=1S/C8H6BrN3OS2/c9-5-1-6(14-3-5)2-10-8(13)7-4-15-12-11-7/h1,3-4H,2H2,(H,10,13) |
| InChIKey | LLVLFEXOUXXPTQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |