C12H10BrNO3S — CID 113254483
N-[(4-bromothiophen-2-yl)methyl]-2,6-dihydroxybenzamide (PubChem CID 113254483) has the molecular formula C12H10BrNO3S and a molecular weight of 328.19 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2,6-dihydroxybenzamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 113254483 |
| Molecular Formula | C12H10BrNO3S |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 326.96 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2,6-dihydroxybenzamide |
| SMILES | O=C(NCc1cc(Br)cs1)c1c(O)cccc1O |
| InChI | InChI=1S/C12H10BrNO3S/c13-7-4-8(18-6-7)5-14-12(17)11-9(15)2-1-3-10(11)16/h1-4,6,15-16H,5H2,(H,14,17) |
| InChIKey | LMUWUTBLWRTOBL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |