C13H12BrNOS2 — CID 112729651
N-[(4-bromothiophen-2-yl)methyl]-2-methylsulfanylbenzamide (PubChem CID 112729651) has the molecular formula C13H12BrNOS2 and a molecular weight of 342.28 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-methylsulfanylbenzamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 112729651 |
| Molecular Formula | C13H12BrNOS2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 340.95 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-methylsulfanylbenzamide |
| SMILES | CSc1ccccc1C(=O)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C13H12BrNOS2/c1-17-12-5-3-2-4-11(12)13(16)15-7-10-6-9(14)8-18-10/h2-6,8H,7H2,1H3,(H,15,16) |
| InChIKey | KOGMCUZQEHOYOR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |