C12H10Br2N2OS — CID 79723749
2-amino-4-bromo-N-[(4-bromothiophen-2-yl)methyl]benzamide (PubChem CID 79723749) has the molecular formula C12H10Br2N2OS and a molecular weight of 390.10 g/mol. Its IUPAC name is 2-amino-4-bromo-N-[(4-bromothiophen-2-yl)methyl]benzamide.
| Compound Name | 2-amino-4-bromo-N-[(4-bromothiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 79723749 |
| Molecular Formula | C12H10Br2N2OS |
| Molecular Weight | 390.10 g/mol |
| Exact Mass | 387.89 |
| IUPAC Name | 2-amino-4-bromo-N-[(4-bromothiophen-2-yl)methyl]benzamide |
| SMILES | Nc1cc(Br)ccc1C(=O)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C12H10Br2N2OS/c13-7-1-2-10(11(15)4-7)12(17)16-5-9-3-8(14)6-18-9/h1-4,6H,5,15H2,(H,16,17) |
| InChIKey | XPEHPLVBOYSVHO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.10 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|