C12H8BrClFNOS — CID 80979266
N-[(4-bromothiophen-2-yl)methyl]-3-chloro-2-fluorobenzamide (PubChem CID 80979266) has the molecular formula C12H8BrClFNOS and a molecular weight of 348.62 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-3-chloro-2-fluorobenzamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-3-chloro-2-fluorobenzamide |
|---|---|
| PubChem CID | 80979266 |
| Molecular Formula | C12H8BrClFNOS |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 346.92 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-3-chloro-2-fluorobenzamide |
| SMILES | O=C(NCc1cc(Br)cs1)c1cccc(Cl)c1F |
| InChI | InChI=1S/C12H8BrClFNOS/c13-7-4-8(18-6-7)5-16-12(17)9-2-1-3-10(14)11(9)15/h1-4,6H,5H2,(H,16,17) |
| InChIKey | OIXRPMNYXKHDEY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |