C19H14Br2N2O2S — CID 55972093
2-[(2-bromobenzoyl)amino]-N-[(4-bromothiophen-2-yl)methyl]benzamide (PubChem CID 55972093) has the molecular formula C19H14Br2N2O2S and a molecular weight of 494.21 g/mol. Its IUPAC name is 2-[(2-bromobenzoyl)amino]-N-[(4-bromothiophen-2-yl)methyl]benzamide.
| Compound Name | 2-[(2-bromobenzoyl)amino]-N-[(4-bromothiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55972093 |
| Molecular Formula | C19H14Br2N2O2S |
| Molecular Weight | 494.21 g/mol |
| Exact Mass | 491.91 |
| IUPAC Name | 2-[(2-bromobenzoyl)amino]-N-[(4-bromothiophen-2-yl)methyl]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCc1cc(Br)cs1)c1ccccc1Br |
| InChI | InChI=1S/C19H14Br2N2O2S/c20-12-9-13(26-11-12)10-22-18(24)15-6-2-4-8-17(15)23-19(25)14-5-1-3-7-16(14)21/h1-9,11H,10H2,(H,22,24)(H,23,25) |
| InChIKey | FPIGETWURGWKJI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.21 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |