C10H8BrNOS3 — CID 107030617
N-[(4-bromothiophen-2-yl)methyl]-4-sulfanylthiophene-2-carboxamide (PubChem CID 107030617) has the molecular formula C10H8BrNOS3 and a molecular weight of 334.29 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107030617 |
| Molecular Formula | C10H8BrNOS3 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 332.90 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-4-sulfanylthiophene-2-carboxamide |
| SMILES | O=C(NCc1cc(Br)cs1)c1cc(S)cs1 |
| InChI | InChI=1S/C10H8BrNOS3/c11-6-1-8(15-4-6)3-12-10(13)9-2-7(14)5-16-9/h1-2,4-5,14H,3H2,(H,12,13) |
| InChIKey | CCOFRXPDZBDKJL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|