C13H10F3NOS2 — CID 107028783
4-sulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]thiophene-2-carboxamide (PubChem CID 107028783) has the molecular formula C13H10F3NOS2 and a molecular weight of 317.36 g/mol. Its IUPAC name is 4-sulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | 4-sulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 107028783 |
| Molecular Formula | C13H10F3NOS2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 4-sulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)c1cc(S)cs1 |
| InChI | InChI=1S/C13H10F3NOS2/c14-13(15,16)9-3-1-8(2-4-9)6-17-12(18)11-5-10(19)7-20-11/h1-5,7,19H,6H2,(H,17,18) |
| InChIKey | VAQAUICTQHEDQR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|