C12H9F3N2OS2 — CID 71610520
2-sulfanylidene-N-[[4-(trifluoromethyl)phenyl]methyl]-3H-1,3-thiazole-4-carboxamide (PubChem CID 71610520) has the molecular formula C12H9F3N2OS2 and a molecular weight of 318.35 g/mol. Its IUPAC name is 2-sulfanylidene-N-[[4-(trifluoromethyl)phenyl]methyl]-3H-1,3-thiazole-4-carboxamide.
| Compound Name | 2-sulfanylidene-N-[[4-(trifluoromethyl)phenyl]methyl]-3H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 71610520 |
| Molecular Formula | C12H9F3N2OS2 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 2-sulfanylidene-N-[[4-(trifluoromethyl)phenyl]methyl]-3H-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)c1csc(=S)[nH]1 |
| InChI | InChI=1S/C12H9F3N2OS2/c13-12(14,15)8-3-1-7(2-4-8)5-16-10(18)9-6-20-11(19)17-9/h1-4,6H,5H2,(H,16,18)(H,17,19) |
| InChIKey | WCKPDTPZIMCKBC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|