C16H13F4NOS — CID 146211391
2-(3-fluoro-4-sulfanylphenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 146211391) has the molecular formula C16H13F4NOS and a molecular weight of 343.35 g/mol. Its IUPAC name is 2-(3-fluoro-4-sulfanylphenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(3-fluoro-4-sulfanylphenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 146211391 |
| Molecular Formula | C16H13F4NOS |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2-(3-fluoro-4-sulfanylphenyl)-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | O=C(Cc1ccc(S)c(F)c1)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13F4NOS/c17-13-7-11(3-6-14(13)23)8-15(22)21-9-10-1-4-12(5-2-10)16(18,19)20/h1-7,23H,8-9H2,(H,21,22) |
| InChIKey | CMRAEPWHQIQCRR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|