C15H20F3NOS — CID 118721865
7-sulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]heptanamide (PubChem CID 118721865) has the molecular formula C15H20F3NOS and a molecular weight of 319.39 g/mol. Its IUPAC name is 7-sulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]heptanamide.
| Compound Name | 7-sulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]heptanamide |
|---|---|
| PubChem CID | 118721865 |
| Molecular Formula | C15H20F3NOS |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 7-sulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]heptanamide |
| SMILES | O=C(CCCCCCS)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H20F3NOS/c16-15(17,18)13-8-6-12(7-9-13)11-19-14(20)5-3-1-2-4-10-21/h6-9,21H,1-5,10-11H2,(H,19,20) |
| InChIKey | USHSMQJPFGHNIF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|