C13H17F3N2O — CID 55129127
3-(ethylamino)-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 55129127) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is 3-(ethylamino)-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | 3-(ethylamino)-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 55129127 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 3-(ethylamino)-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | CCNCCC(=O)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3N2O/c1-2-17-8-7-12(19)18-9-10-3-5-11(6-4-10)13(14,15)16/h3-6,17H,2,7-9H2,1H3,(H,18,19) |
| InChIKey | FEQGXZAOHGAPOZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|