C19H18F3NO2 — CID 25402695
4-(4-methylphenyl)-4-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]butanamide (PubChem CID 25402695) has the molecular formula C19H18F3NO2 and a molecular weight of 349.35 g/mol. Its IUPAC name is 4-(4-methylphenyl)-4-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]butanamide.
| Compound Name | 4-(4-methylphenyl)-4-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 25402695 |
| Molecular Formula | C19H18F3NO2 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 4-(4-methylphenyl)-4-oxo-N-[[4-(trifluoromethyl)phenyl]methyl]butanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)NCc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H18F3NO2/c1-13-2-6-15(7-3-13)17(24)10-11-18(25)23-12-14-4-8-16(9-5-14)19(20,21)22/h2-9H,10-12H2,1H3,(H,23,25) |
| InChIKey | BNJSZYVGRNZSLS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |