C12H12F3NO — CID 59536949
N-[[4-(trifluoromethyl)phenyl]methyl]but-3-enamide (PubChem CID 59536949) has the molecular formula C12H12F3NO and a molecular weight of 243.23 g/mol. Its IUPAC name is N-[[4-(trifluoromethyl)phenyl]methyl]but-3-enamide.
| Compound Name | N-[[4-(trifluoromethyl)phenyl]methyl]but-3-enamide |
|---|---|
| PubChem CID | 59536949 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-[[4-(trifluoromethyl)phenyl]methyl]but-3-enamide |
| SMILES | C=CCC(=O)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H12F3NO/c1-2-3-11(17)16-8-9-4-6-10(7-5-9)12(13,14)15/h2,4-7H,1,3,8H2,(H,16,17) |
| InChIKey | YKWHYSYTRYJVEH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|