C13H11NO3S2 — CID 107028822
N-(1,3-benzodioxol-5-ylmethyl)-4-sulfanylthiophene-2-carboxamide (PubChem CID 107028822) has the molecular formula C13H11NO3S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107028822 |
| Molecular Formula | C13H11NO3S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-sulfanylthiophene-2-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1cc(S)cs1 |
| InChI | InChI=1S/C13H11NO3S2/c15-13(12-4-9(18)6-19-12)14-5-8-1-2-10-11(3-8)17-7-16-10/h1-4,6,18H,5,7H2,(H,14,15) |
| InChIKey | MDVXSXQMVPGAEL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|