C13H12N2O4 — CID 82344120
5-amino-N-(1,3-benzodioxol-5-ylmethyl)furan-2-carboxamide (PubChem CID 82344120) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 5-amino-N-(1,3-benzodioxol-5-ylmethyl)furan-2-carboxamide.
| Compound Name | 5-amino-N-(1,3-benzodioxol-5-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 82344120 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 5-amino-N-(1,3-benzodioxol-5-ylmethyl)furan-2-carboxamide |
| SMILES | Nc1ccc(C(=O)NCc2ccc3c(c2)OCO3)o1 |
| InChI | InChI=1S/C13H12N2O4/c14-12-4-3-10(19-12)13(16)15-6-8-1-2-9-11(5-8)18-7-17-9/h1-5H,6-7,14H2,(H,15,16) |
| InChIKey | NLZTXEDTRXGAOS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |