C21H17NO5 — CID 17460136
5-(4-acetylphenyl)-N-(1,3-benzodioxol-5-ylmethyl)furan-2-carboxamide (PubChem CID 17460136) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is 5-(4-acetylphenyl)-N-(1,3-benzodioxol-5-ylmethyl)furan-2-carboxamide.
| Compound Name | 5-(4-acetylphenyl)-N-(1,3-benzodioxol-5-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17460136 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 5-(4-acetylphenyl)-N-(1,3-benzodioxol-5-ylmethyl)furan-2-carboxamide |
| SMILES | CC(=O)c1ccc(-c2ccc(C(=O)NCc3ccc4c(c3)OCO4)o2)cc1 |
| InChI | InChI=1S/C21H17NO5/c1-13(23)15-3-5-16(6-4-15)17-8-9-19(27-17)21(24)22-11-14-2-7-18-20(10-14)26-12-25-18/h2-10H,11-12H2,1H3,(H,22,24) |
| InChIKey | ANTCMSLWNSFWPT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |