C7H9BrN2OS — CID 23548634
1-[(4-bromothiophen-2-yl)methyl]-3-methylurea (PubChem CID 23548634) has the molecular formula C7H9BrN2OS and a molecular weight of 249.13 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-3-methylurea.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-3-methylurea |
|---|---|
| PubChem CID | 23548634 |
| Molecular Formula | C7H9BrN2OS |
| Molecular Weight | 249.13 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-3-methylurea |
| SMILES | CNC(=O)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C7H9BrN2OS/c1-9-7(11)10-3-6-2-5(8)4-12-6/h2,4H,3H2,1H3,(H2,9,10,11) |
| InChIKey | BRHMVJIDTXFJOJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.13 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |