C9H13BrN2O2S — CID 110894395
1-[(4-bromothiophen-2-yl)methyl]-3-(3-hydroxypropyl)urea (PubChem CID 110894395) has the molecular formula C9H13BrN2O2S and a molecular weight of 293.19 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-3-(3-hydroxypropyl)urea.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 110894395 |
| Molecular Formula | C9H13BrN2O2S |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-3-(3-hydroxypropyl)urea |
| SMILES | O=C(NCCCO)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C9H13BrN2O2S/c10-7-4-8(15-6-7)5-12-9(14)11-2-1-3-13/h4,6,13H,1-3,5H2,(H2,11,12,14) |
| InChIKey | OKJHHTUDGQLPHZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|