C14H13BrFN3O2S — CID 49255504
2-[(4-bromothiophen-2-yl)methylcarbamoylamino]-N-(4-fluorophenyl)acetamide (PubChem CID 49255504) has the molecular formula C14H13BrFN3O2S and a molecular weight of 386.25 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methylcarbamoylamino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(4-bromothiophen-2-yl)methylcarbamoylamino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 49255504 |
| Molecular Formula | C14H13BrFN3O2S |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methylcarbamoylamino]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(CNC(=O)NCc1cc(Br)cs1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C14H13BrFN3O2S/c15-9-5-12(22-8-9)6-17-14(21)18-7-13(20)19-11-3-1-10(16)2-4-11/h1-5,8H,6-7H2,(H,19,20)(H2,17,18,21) |
| InChIKey | MUUQNSVUVRZGBT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |