C9H10BrNOS — CID 47250199
N-[(4-bromothiophen-2-yl)methyl]cyclopropanecarboxamide (PubChem CID 47250199) has the molecular formula C9H10BrNOS and a molecular weight of 260.16 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]cyclopropanecarboxamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 47250199 |
| Molecular Formula | C9H10BrNOS |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 258.97 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]cyclopropanecarboxamide |
| SMILES | O=C(NCc1cc(Br)cs1)C1CC1 |
| InChI | InChI=1S/C9H10BrNOS/c10-7-3-8(13-5-7)4-11-9(12)6-1-2-6/h3,5-6H,1-2,4H2,(H,11,12) |
| InChIKey | CNDCZSYQEFHXJH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |