C12H14BrNOS — CID 47250169
N-[(4-bromothiophen-2-yl)methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 47250169) has the molecular formula C12H14BrNOS and a molecular weight of 300.22 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 47250169 |
| Molecular Formula | C12H14BrNOS |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NCc1cc(Br)cs1)C1CC=CCC1 |
| InChI | InChI=1S/C12H14BrNOS/c13-10-6-11(16-8-10)7-14-12(15)9-4-2-1-3-5-9/h1-2,6,8-9H,3-5,7H2,(H,14,15) |
| InChIKey | LXIFMLYRXWEHMQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|