C10H12BrNO2S — CID 103872325
(2S)-N-[(4-bromothiophen-2-yl)methyl]oxolane-2-carboxamide (PubChem CID 103872325) has the molecular formula C10H12BrNO2S and a molecular weight of 290.18 g/mol. Its IUPAC name is (2S)-N-[(4-bromothiophen-2-yl)methyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[(4-bromothiophen-2-yl)methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 103872325 |
| Molecular Formula | C10H12BrNO2S |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | (2S)-N-[(4-bromothiophen-2-yl)methyl]oxolane-2-carboxamide |
| SMILES | O=C(NCc1cc(Br)cs1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C10H12BrNO2S/c11-7-4-8(15-6-7)5-12-10(13)9-2-1-3-14-9/h4,6,9H,1-3,5H2,(H,12,13)/t9-/m0/s1 |
| InChIKey | HKISDODQNCFKQK-VIFPVBQESA-N |
| XLogP | 2.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |