C10H12BrNO3S2 — CID 47250589
N-[(4-bromothiophen-2-yl)methyl]-1,1-dioxothiolane-3-carboxamide (PubChem CID 47250589) has the molecular formula C10H12BrNO3S2 and a molecular weight of 338.25 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 47250589 |
| Molecular Formula | C10H12BrNO3S2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 336.94 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(NCc1cc(Br)cs1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H12BrNO3S2/c11-8-3-9(16-5-8)4-12-10(13)7-1-2-17(14,15)6-7/h3,5,7H,1-2,4,6H2,(H,12,13) |
| InChIKey | YDKPUZZFEQFSNT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |