C13H15NO4S2 — CID 64905801
N-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-1,1-dioxothiolane-3-carboxamide (PubChem CID 64905801) has the molecular formula C13H15NO4S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 64905801 |
| Molecular Formula | C13H15NO4S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | N-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(NCc1ccc(C#CCO)s1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15NO4S2/c15-6-1-2-11-3-4-12(19-11)8-14-13(16)10-5-7-20(17,18)9-10/h3-4,10,15H,5-9H2,(H,14,16) |
| InChIKey | DTNPAAKQFPQGCC-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|