C16H22N2O3S2 — CID 99944965
3-[5-[[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]thiophen-2-yl]prop-2-yn-1-ol (PubChem CID 99944965) has the molecular formula C16H22N2O3S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is 3-[5-[[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]thiophen-2-yl]prop-2-yn-1-ol.
| Compound Name | 3-[5-[[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]thiophen-2-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 99944965 |
| Molecular Formula | C16H22N2O3S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 3-[5-[[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]thiophen-2-yl]prop-2-yn-1-ol |
| SMILES | O=S1(=O)CC[C@@H](N2CCN(Cc3ccc(C#CCO)s3)CC2)C1 |
| InChI | InChI=1S/C16H22N2O3S2/c19-10-1-2-15-3-4-16(22-15)12-17-6-8-18(9-7-17)14-5-11-23(20,21)13-14/h3-4,14,19H,5-13H2/t14-/m1/s1 |
| InChIKey | GZCFDHNXWQGKQQ-CQSZACIVSA-N |
| XLogP | 0.40 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|