C12H13Cl2NO3S — CID 84925742
N-[(2,4-dichlorophenyl)methyl]-1,1-dioxothiolane-3-carboxamide (PubChem CID 84925742) has the molecular formula C12H13Cl2NO3S and a molecular weight of 322.21 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 84925742 |
| Molecular Formula | C12H13Cl2NO3S |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1Cl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H13Cl2NO3S/c13-10-2-1-8(11(14)5-10)6-15-12(16)9-3-4-19(17,18)7-9/h1-2,5,9H,3-4,6-7H2,(H,15,16) |
| InChIKey | QVCAIBGELQEJEV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |