C15H21NO6S — CID 18090481
1,1-dioxo-N-[(2,4,5-trimethoxyphenyl)methyl]thiolane-3-carboxamide (PubChem CID 18090481) has the molecular formula C15H21NO6S and a molecular weight of 343.40 g/mol. Its IUPAC name is 1,1-dioxo-N-[(2,4,5-trimethoxyphenyl)methyl]thiolane-3-carboxamide.
| Compound Name | 1,1-dioxo-N-[(2,4,5-trimethoxyphenyl)methyl]thiolane-3-carboxamide |
|---|---|
| PubChem CID | 18090481 |
| Molecular Formula | C15H21NO6S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1,1-dioxo-N-[(2,4,5-trimethoxyphenyl)methyl]thiolane-3-carboxamide |
| SMILES | COc1cc(OC)c(OC)cc1CNC(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H21NO6S/c1-20-12-7-14(22-3)13(21-2)6-11(12)8-16-15(17)10-4-5-23(18,19)9-10/h6-7,10H,4-5,8-9H2,1-3H3,(H,16,17) |
| InChIKey | YNDVJPZVIIJMFU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |