C15H19NO7S — CID 16566473
methyl 2-[(1,1-dioxothiolane-3-carbonyl)amino]-4,5-dimethoxybenzoate (PubChem CID 16566473) has the molecular formula C15H19NO7S and a molecular weight of 357.38 g/mol. Its IUPAC name is methyl 2-[(1,1-dioxothiolane-3-carbonyl)amino]-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-[(1,1-dioxothiolane-3-carbonyl)amino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 16566473 |
| Molecular Formula | C15H19NO7S |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | methyl 2-[(1,1-dioxothiolane-3-carbonyl)amino]-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1NC(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H19NO7S/c1-21-12-6-10(15(18)23-3)11(7-13(12)22-2)16-14(17)9-4-5-24(19,20)8-9/h6-7,9H,4-5,8H2,1-3H3,(H,16,17) |
| InChIKey | LSJBSIMRNQGUTO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |