C18H24N2O6 — CID 7812130
(2-amino-2-oxoethyl) 2-(cyclohexanecarbonylamino)-4,5-dimethoxybenzoate (PubChem CID 7812130) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-(cyclohexanecarbonylamino)-4,5-dimethoxybenzoate.
| Compound Name | (2-amino-2-oxoethyl) 2-(cyclohexanecarbonylamino)-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 7812130 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-(cyclohexanecarbonylamino)-4,5-dimethoxybenzoate |
| SMILES | COc1cc(NC(=O)C2CCCCC2)c(C(=O)OCC(N)=O)cc1OC |
| InChI | InChI=1S/C18H24N2O6/c1-24-14-8-12(18(23)26-10-16(19)21)13(9-15(14)25-2)20-17(22)11-6-4-3-5-7-11/h8-9,11H,3-7,10H2,1-2H3,(H2,19,21)(H,20,22) |
| InChIKey | AICUXFJSVOVMRU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |