C19H24N2O5 — CID 7812116
[(1R)-1-cyanoethyl] 2-(cyclohexanecarbonylamino)-4,5-dimethoxybenzoate (PubChem CID 7812116) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 2-(cyclohexanecarbonylamino)-4,5-dimethoxybenzoate.
| Compound Name | [(1R)-1-cyanoethyl] 2-(cyclohexanecarbonylamino)-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 7812116 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | [(1R)-1-cyanoethyl] 2-(cyclohexanecarbonylamino)-4,5-dimethoxybenzoate |
| SMILES | COc1cc(NC(=O)C2CCCCC2)c(C(=O)O[C@H](C)C#N)cc1OC |
| InChI | InChI=1S/C19H24N2O5/c1-12(11-20)26-19(23)14-9-16(24-2)17(25-3)10-15(14)21-18(22)13-7-5-4-6-8-13/h9-10,12-13H,4-8H2,1-3H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | RHYUJKPUZSINOT-GFCCVEGCSA-N |
| XLogP | 3.29 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |