C16H23NO4S — CID 41141595
(3R)-N-(5-tert-butyl-2-methoxyphenyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 41141595) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is (3R)-N-(5-tert-butyl-2-methoxyphenyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | (3R)-N-(5-tert-butyl-2-methoxyphenyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 41141595 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (3R)-N-(5-tert-butyl-2-methoxyphenyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | COc1ccc(C(C)(C)C)cc1NC(=O)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H23NO4S/c1-16(2,3)12-5-6-14(21-4)13(9-12)17-15(18)11-7-8-22(19,20)10-11/h5-6,9,11H,7-8,10H2,1-4H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | PWXNDYYRLZFOEJ-NSHDSACASA-N |
| XLogP | 2.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |