C19H20N2O5S — CID 9083679
(3S)-N-[4-[(2-methoxyphenyl)carbamoyl]phenyl]-1,1-dioxothiolane-3-carboxamide (PubChem CID 9083679) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is (3S)-N-[4-[(2-methoxyphenyl)carbamoyl]phenyl]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | (3S)-N-[4-[(2-methoxyphenyl)carbamoyl]phenyl]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 9083679 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (3S)-N-[4-[(2-methoxyphenyl)carbamoyl]phenyl]-1,1-dioxothiolane-3-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC(=O)[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C19H20N2O5S/c1-26-17-5-3-2-4-16(17)21-18(22)13-6-8-15(9-7-13)20-19(23)14-10-11-27(24,25)12-14/h2-9,14H,10-12H2,1H3,(H,20,23)(H,21,22)/t14-/m1/s1 |
| InChIKey | APZAIWMXRLMKQN-CQSZACIVSA-N |
| XLogP | 2.32 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |