C23H28N4O4 — CID 121063317
4-(cyclopentanecarbonylamino)-N-[2-[(2-methoxyphenyl)carbamoylamino]ethyl]benzamide (PubChem CID 121063317) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 4-(cyclopentanecarbonylamino)-N-[2-[(2-methoxyphenyl)carbamoylamino]ethyl]benzamide.
| Compound Name | 4-(cyclopentanecarbonylamino)-N-[2-[(2-methoxyphenyl)carbamoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 121063317 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 4-(cyclopentanecarbonylamino)-N-[2-[(2-methoxyphenyl)carbamoylamino]ethyl]benzamide |
| SMILES | COc1ccccc1NC(=O)NCCNC(=O)c1ccc(NC(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C23H28N4O4/c1-31-20-9-5-4-8-19(20)27-23(30)25-15-14-24-21(28)17-10-12-18(13-11-17)26-22(29)16-6-2-3-7-16/h4-5,8-13,16H,2-3,6-7,14-15H2,1H3,(H,24,28)(H,26,29)(H2,25,27,30) |
| InChIKey | UHZHTGXKXHOHBS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|