C24H29N3O5 — CID 42426783
N-[4-[[[(2S)-2-(2-methoxyphenoxy)propanoyl]amino]carbamoyl]phenyl]cyclohexanecarboxamide (PubChem CID 42426783) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is N-[4-[[[(2S)-2-(2-methoxyphenoxy)propanoyl]amino]carbamoyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[[[(2S)-2-(2-methoxyphenoxy)propanoyl]amino]carbamoyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 42426783 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-[4-[[[(2S)-2-(2-methoxyphenoxy)propanoyl]amino]carbamoyl]phenyl]cyclohexanecarboxamide |
| SMILES | COc1ccccc1O[C@@H](C)C(=O)NNC(=O)c1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H29N3O5/c1-16(32-21-11-7-6-10-20(21)31-2)22(28)26-27-24(30)18-12-14-19(15-13-18)25-23(29)17-8-4-3-5-9-17/h6-7,10-17H,3-5,8-9H2,1-2H3,(H,25,29)(H,26,28)(H,27,30)/t16-/m0/s1 |
| InChIKey | QDTRXXMXNACAAJ-INIZCTEOSA-N |
| XLogP | 3.44 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|