C20H30N4O3 — CID 121063312
N-[2-(tert-butylcarbamoylamino)ethyl]-4-(cyclopentanecarbonylamino)benzamide (PubChem CID 121063312) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[2-(tert-butylcarbamoylamino)ethyl]-4-(cyclopentanecarbonylamino)benzamide.
| Compound Name | N-[2-(tert-butylcarbamoylamino)ethyl]-4-(cyclopentanecarbonylamino)benzamide |
|---|---|
| PubChem CID | 121063312 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | N-[2-(tert-butylcarbamoylamino)ethyl]-4-(cyclopentanecarbonylamino)benzamide |
| SMILES | CC(C)(C)NC(=O)NCCNC(=O)c1ccc(NC(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C20H30N4O3/c1-20(2,3)24-19(27)22-13-12-21-17(25)15-8-10-16(11-9-15)23-18(26)14-6-4-5-7-14/h8-11,14H,4-7,12-13H2,1-3H3,(H,21,25)(H,23,26)(H2,22,24,27) |
| InChIKey | ZNJZFEFDZPPRCN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|