C23H27ClN4O3 — CID 121063337
N-[2-[(4-chlorophenyl)methylcarbamoylamino]ethyl]-4-(cyclopentanecarbonylamino)benzamide (PubChem CID 121063337) has the molecular formula C23H27ClN4O3 and a molecular weight of 442.95 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylcarbamoylamino]ethyl]-4-(cyclopentanecarbonylamino)benzamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylcarbamoylamino]ethyl]-4-(cyclopentanecarbonylamino)benzamide |
|---|---|
| PubChem CID | 121063337 |
| Molecular Formula | C23H27ClN4O3 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylcarbamoylamino]ethyl]-4-(cyclopentanecarbonylamino)benzamide |
| SMILES | O=C(NCCNC(=O)c1ccc(NC(=O)C2CCCC2)cc1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H27ClN4O3/c24-19-9-5-16(6-10-19)15-27-23(31)26-14-13-25-21(29)18-7-11-20(12-8-18)28-22(30)17-3-1-2-4-17/h5-12,17H,1-4,13-15H2,(H,25,29)(H,28,30)(H2,26,27,31) |
| InChIKey | CCMJQWYUOUNMLD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|